6-(3,4-dimethylphenyl)-3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
6-(3,4-dimethylphenyl)-3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
6-(3,4-dimethylphenyl)-3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | D221-0261 |
| Compound Name: | 6-(3,4-dimethylphenyl)-3-methyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 244.32 |
| Molecular Formula: | C12 H12 N4 S |
| Smiles: | Cc1ccc(cc1C)c1nn2c(C)nnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 2.64 |
| logD: | 2.64 |
| logSw: | -2.646 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 34.77 |
| InChI Key: | RBOITCJVGQKTFA-UHFFFAOYSA-N |