N-(3-chloro-4-methoxyphenyl)-4-oxo-1-phenyl-1,4-dihydropyridazine-3-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-4-oxo-1-phenyl-1,4-dihydropyridazine-3-carboxamide
N-(3-chloro-4-methoxyphenyl)-4-oxo-1-phenyl-1,4-dihydropyridazine-3-carboxamide
Compound characteristics
| Compound ID: | D223-0032 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-4-oxo-1-phenyl-1,4-dihydropyridazine-3-carboxamide |
| Molecular Weight: | 355.78 |
| Molecular Formula: | C18 H14 Cl N3 O3 |
| Smiles: | [H]N(C(C1C(C=CN(c2ccccc2)N=1)=O)=O)c1ccc(c(c1)[Cl])OC |
| Stereo: | ACHIRAL |
| logP: | 3.2495 |
| logD: | 2.7921 |
| logSw: | -3.6419 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.37 |
| InChI Key: | SHPNWUBONVKUDT-UHFFFAOYSA-N |