N-(4-ethoxyphenyl)-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
N-(4-ethoxyphenyl)-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Compound characteristics
| Compound ID: | D223-0054 |
| Compound Name: | N-(4-ethoxyphenyl)-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide |
| Molecular Weight: | 349.39 |
| Molecular Formula: | C20 H19 N3 O3 |
| Smiles: | [H]N(C(C1C(C=CN(c2ccc(C)cc2)N=1)=O)=O)c1ccc(cc1)OCC |
| Stereo: | ACHIRAL |
| logP: | 3.6528 |
| logD: | 3.6422 |
| logSw: | -3.6643 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.864 |
| InChI Key: | AASURCLIFUXWTB-UHFFFAOYSA-N |