1-(4-fluorophenyl)-4-oxo-N-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridazine-3-carboxamide
Chemical Structure Depiction of
1-(4-fluorophenyl)-4-oxo-N-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridazine-3-carboxamide
1-(4-fluorophenyl)-4-oxo-N-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridazine-3-carboxamide
Compound characteristics
| Compound ID: | D223-0334 |
| Compound Name: | 1-(4-fluorophenyl)-4-oxo-N-[3-(trifluoromethyl)phenyl]-1,4-dihydropyridazine-3-carboxamide |
| Molecular Weight: | 377.3 |
| Molecular Formula: | C18 H11 F4 N3 O2 |
| Smiles: | [H]N(C(C1C(C=CN(c2ccc(cc2)F)N=1)=O)=O)c1cccc(c1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 3.9328 |
| logD: | 3.3333 |
| logSw: | -4.2028 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.74 |
| InChI Key: | BDGBHFIENBZRKY-UHFFFAOYSA-N |