N,1-bis(4-ethylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Chemical Structure Depiction of
N,1-bis(4-ethylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
N,1-bis(4-ethylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Compound characteristics
| Compound ID: | D223-0402 |
| Compound Name: | N,1-bis(4-ethylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide |
| Molecular Weight: | 347.42 |
| Molecular Formula: | C21 H21 N3 O2 |
| Smiles: | [H]N(C(C1C(C=CN(c2ccc(CC)cc2)N=1)=O)=O)c1ccc(CC)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7218 |
| logD: | 4.7151 |
| logSw: | -4.3552 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.74 |
| InChI Key: | WDDZBHANVICSOG-UHFFFAOYSA-N |