1-(3-chlorophenyl)-3,6-dimethyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine
Chemical Structure Depiction of
1-(3-chlorophenyl)-3,6-dimethyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine
1-(3-chlorophenyl)-3,6-dimethyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine
Compound characteristics
| Compound ID: | D224-0120 |
| Compound Name: | 1-(3-chlorophenyl)-3,6-dimethyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine |
| Molecular Weight: | 325.72 |
| Molecular Formula: | C15 H11 Cl F3 N3 |
| Smiles: | Cc1cc(c2c(C)nn(c3cccc(c3)[Cl])c2n1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 4.384 |
| logD: | 4.384 |
| logSw: | -4.6963 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 23.4405 |
| InChI Key: | JXWJHKGILYIBNU-UHFFFAOYSA-N |