1,3-dimethyl-8-(morpholin-4-yl)-7-(prop-2-en-1-yl)-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
1,3-dimethyl-8-(morpholin-4-yl)-7-(prop-2-en-1-yl)-3,7-dihydro-1H-purine-2,6-dione
1,3-dimethyl-8-(morpholin-4-yl)-7-(prop-2-en-1-yl)-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | D226-0046 |
| Compound Name: | 1,3-dimethyl-8-(morpholin-4-yl)-7-(prop-2-en-1-yl)-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 305.33 |
| Molecular Formula: | C14 H19 N5 O3 |
| Smiles: | CN1C(c2c(nc(N3CCOCC3)n2CC=C)N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4282 |
| logD: | 1.4281 |
| logSw: | -1.4355 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.856 |
| InChI Key: | NTZASSPKHIUIRP-UHFFFAOYSA-N |