N-{[4-(dimethylamino)phenyl]methyl}-3,6-dimethyl-N-[(oxolan-2-yl)methyl]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-{[4-(dimethylamino)phenyl]methyl}-3,6-dimethyl-N-[(oxolan-2-yl)methyl]-1-benzofuran-2-carboxamide
N-{[4-(dimethylamino)phenyl]methyl}-3,6-dimethyl-N-[(oxolan-2-yl)methyl]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D232-0181 |
| Compound Name: | N-{[4-(dimethylamino)phenyl]methyl}-3,6-dimethyl-N-[(oxolan-2-yl)methyl]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 406.52 |
| Molecular Formula: | C25 H30 N2 O3 |
| Smiles: | Cc1ccc2c(C)c(C(N(CC3CCCO3)Cc3ccc(cc3)N(C)C)=O)oc2c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6763 |
| logD: | 4.6609 |
| logSw: | -4.5172 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.163 |
| InChI Key: | UOLFFVUOTJEDHY-OAQYLSRUSA-N |