5-chloro-2-[(4-fluorophenyl)methanesulfonyl]-N-(2-methylphenyl)pyrimidine-4-carboxamide
Chemical Structure Depiction of
5-chloro-2-[(4-fluorophenyl)methanesulfonyl]-N-(2-methylphenyl)pyrimidine-4-carboxamide
5-chloro-2-[(4-fluorophenyl)methanesulfonyl]-N-(2-methylphenyl)pyrimidine-4-carboxamide
Compound characteristics
| Compound ID: | D233-0310 |
| Compound Name: | 5-chloro-2-[(4-fluorophenyl)methanesulfonyl]-N-(2-methylphenyl)pyrimidine-4-carboxamide |
| Molecular Weight: | 419.86 |
| Molecular Formula: | C19 H15 Cl F N3 O3 S |
| Smiles: | [H]N(C(c1c(cnc(n1)S(Cc1ccc(cc1)F)(=O)=O)[Cl])=O)c1ccccc1C |
| Stereo: | ACHIRAL |
| logP: | 3.3757 |
| logD: | 3.3521 |
| logSw: | -3.5359 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.81 |
| InChI Key: | PZBBFLARIRNQCQ-UHFFFAOYSA-N |