5-chloro-N-{4-[ethyl(phenyl)sulfamoyl]phenyl}-2-[(propan-2-yl)sulfanyl]pyrimidine-4-carboxamide
Chemical Structure Depiction of
5-chloro-N-{4-[ethyl(phenyl)sulfamoyl]phenyl}-2-[(propan-2-yl)sulfanyl]pyrimidine-4-carboxamide
5-chloro-N-{4-[ethyl(phenyl)sulfamoyl]phenyl}-2-[(propan-2-yl)sulfanyl]pyrimidine-4-carboxamide
Compound characteristics
| Compound ID: | D233-0777 |
| Compound Name: | 5-chloro-N-{4-[ethyl(phenyl)sulfamoyl]phenyl}-2-[(propan-2-yl)sulfanyl]pyrimidine-4-carboxamide |
| Molecular Weight: | 491.03 |
| Molecular Formula: | C22 H23 Cl N4 O3 S2 |
| Smiles: | [H]N(C(c1c(cnc(n1)SC(C)C)[Cl])=O)c1ccc(cc1)S(N(CC)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1115 |
| logD: | 5.0165 |
| logSw: | -5.4712 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.465 |
| InChI Key: | CZLVAFPPAJJQEL-UHFFFAOYSA-N |