butyl (4-oxo-6-phenylthieno[2,3-d][1,2,3]triazin-3(4H)-yl)acetate
Chemical Structure Depiction of
butyl (4-oxo-6-phenylthieno[2,3-d][1,2,3]triazin-3(4H)-yl)acetate
butyl (4-oxo-6-phenylthieno[2,3-d][1,2,3]triazin-3(4H)-yl)acetate
Compound characteristics
| Compound ID: | D243-0170 |
| Compound Name: | butyl (4-oxo-6-phenylthieno[2,3-d][1,2,3]triazin-3(4H)-yl)acetate |
| Molecular Weight: | 343.4 |
| Molecular Formula: | C17 H17 N3 O3 S |
| Smiles: | CCCCOC(CN1C(c2cc(c3ccccc3)sc2N=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9076 |
| logD: | 3.9076 |
| logSw: | -3.8573 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.288 |
| InChI Key: | ZZVQGTCYFFGGQH-UHFFFAOYSA-N |