2-[4-(7-methyl-4-oxo-5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-3(4H)-yl)butyl]-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-[4-(7-methyl-4-oxo-5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-3(4H)-yl)butyl]-1H-isoindole-1,3(2H)-dione
2-[4-(7-methyl-4-oxo-5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-3(4H)-yl)butyl]-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | D243-0329 |
| Compound Name: | 2-[4-(7-methyl-4-oxo-5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-3(4H)-yl)butyl]-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C22 H22 N4 O3 S |
| Smiles: | CC1CCc2c3C(N(CCCCN4C(c5ccccc5C4=O)=O)N=Nc3sc2C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0931 |
| logD: | 4.0931 |
| logSw: | -4.3556 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 70.237 |
| InChI Key: | JFOKGXLQOJUPFO-CYBMUJFWSA-N |