2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D245-0169 |
| Compound Name: | 2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 363.85 |
| Molecular Formula: | C20 H18 Cl N5 |
| Smiles: | Cc1cccc(C)c1Nc1cc(C)nc2nc(c3ccc(cc3)[Cl])nn12 |
| Stereo: | ACHIRAL |
| logP: | 5.0065 |
| logD: | 4.9919 |
| logSw: | -5.2792 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.445 |
| InChI Key: | NBEXXUYUYRRQRB-UHFFFAOYSA-N |