2-(4-tert-butylphenyl)-N-(2-chlorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
2-(4-tert-butylphenyl)-N-(2-chlorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
2-(4-tert-butylphenyl)-N-(2-chlorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D245-0221 |
| Compound Name: | 2-(4-tert-butylphenyl)-N-(2-chlorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 391.9 |
| Molecular Formula: | C22 H22 Cl N5 |
| Smiles: | Cc1cc(Nc2ccccc2[Cl])n2c(n1)nc(c1ccc(cc1)C(C)(C)C)n2 |
| Stereo: | ACHIRAL |
| logP: | 6.2542 |
| logD: | 6.2395 |
| logSw: | -6.3314 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.142 |
| InChI Key: | RHJXMNQSTNURKU-UHFFFAOYSA-N |