5-methyl-2-(3-methylphenyl)-7-(piperidin-1-yl)[1,2,4]triazolo[1,5-a]pyrimidine
Chemical Structure Depiction of
5-methyl-2-(3-methylphenyl)-7-(piperidin-1-yl)[1,2,4]triazolo[1,5-a]pyrimidine
5-methyl-2-(3-methylphenyl)-7-(piperidin-1-yl)[1,2,4]triazolo[1,5-a]pyrimidine
Compound characteristics
| Compound ID: | D245-0395 |
| Compound Name: | 5-methyl-2-(3-methylphenyl)-7-(piperidin-1-yl)[1,2,4]triazolo[1,5-a]pyrimidine |
| Molecular Weight: | 307.4 |
| Molecular Formula: | C18 H21 N5 |
| Smiles: | Cc1cccc(c1)c1nc2nc(C)cc(N3CCCCC3)n2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.1765 |
| logD: | 3.9528 |
| logSw: | -4.2281 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.117 |
| InChI Key: | DLGZUMSLFAJSTH-UHFFFAOYSA-N |