N~4~-{2-[(4-chlorophenyl)methyl]-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-N~1~,N~1~-dimethylbenzene-1,4-diamine
Chemical Structure Depiction of
N~4~-{2-[(4-chlorophenyl)methyl]-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-N~1~,N~1~-dimethylbenzene-1,4-diamine
N~4~-{2-[(4-chlorophenyl)methyl]-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-N~1~,N~1~-dimethylbenzene-1,4-diamine
Compound characteristics
| Compound ID: | D245-0610 |
| Compound Name: | N~4~-{2-[(4-chlorophenyl)methyl]-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-N~1~,N~1~-dimethylbenzene-1,4-diamine |
| Molecular Weight: | 392.89 |
| Molecular Formula: | C21 H21 Cl N6 |
| Smiles: | Cc1cc(Nc2ccc(cc2)N(C)C)n2c(n1)nc(Cc1ccc(cc1)[Cl])n2 |
| Stereo: | ACHIRAL |
| logP: | 4.5657 |
| logD: | 4.5547 |
| logSw: | -4.6519 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.636 |
| InChI Key: | XAXQWIJLGGYSPV-UHFFFAOYSA-N |