N-{1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}cyclohexanecarboxamide
Chemical Structure Depiction of
N-{1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}cyclohexanecarboxamide
N-{1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}cyclohexanecarboxamide
Compound characteristics
| Compound ID: | D247-0018 |
| Compound Name: | N-{1-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}cyclohexanecarboxamide |
| Molecular Weight: | 333.82 |
| Molecular Formula: | C17 H20 Cl N3 O2 |
| Smiles: | CC(c1nc(c2ccccc2[Cl])no1)NC(C1CCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1586 |
| logD: | 4.1586 |
| logSw: | -4.4324 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.684 |
| InChI Key: | XBYXUBHKYICDDJ-NSHDSACASA-N |