N-{1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}benzenesulfonamide
Chemical Structure Depiction of
N-{1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}benzenesulfonamide
N-{1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}benzenesulfonamide
Compound characteristics
| Compound ID: | D247-0375 |
| Compound Name: | N-{1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}benzenesulfonamide |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C17 H17 N3 O4 S |
| Smiles: | CC(c1nc(c2ccccc2OC)no1)NS(c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3331 |
| logD: | 3.2471 |
| logSw: | -3.9596 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.681 |
| InChI Key: | AKBLBFVIBPNPON-LBPRGKRZSA-N |