N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide
Chemical Structure Depiction of
N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide
N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide
Compound characteristics
| Compound ID: | D247-0722 |
| Compound Name: | N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide |
| Molecular Weight: | 231.25 |
| Molecular Formula: | C12 H13 N3 O2 |
| Smiles: | CCC(NCc1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2692 |
| logD: | 2.2692 |
| logSw: | -2.5666 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.053 |
| InChI Key: | KYGSBHXRWOBUGL-UHFFFAOYSA-N |