5-(4-bromophenyl)-6-cyclohexyl-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
Chemical Structure Depiction of
5-(4-bromophenyl)-6-cyclohexyl-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
5-(4-bromophenyl)-6-cyclohexyl-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione
Compound characteristics
| Compound ID: | D252-0073 |
| Compound Name: | 5-(4-bromophenyl)-6-cyclohexyl-1,3-dimethyl-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,6H)-dione |
| Molecular Weight: | 416.32 |
| Molecular Formula: | C20 H22 Br N3 O2 |
| Smiles: | CN1C(c2c(cn(C3CCCCC3)c2c2ccc(cc2)[Br])N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6312 |
| logD: | 4.6312 |
| logSw: | -4.3745 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.62 |
| InChI Key: | SBWARMKPBOZXSI-UHFFFAOYSA-N |