N-(2,3-dimethylphenyl)-1-(methanesulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-1-(methanesulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
N-(2,3-dimethylphenyl)-1-(methanesulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | D256-0034 |
| Compound Name: | N-(2,3-dimethylphenyl)-1-(methanesulfonyl)-2,3-dihydro-1H-indole-5-carboxamide |
| Molecular Weight: | 344.43 |
| Molecular Formula: | C18 H20 N2 O3 S |
| Smiles: | Cc1cccc(c1C)NC(c1ccc2c(CCN2S(C)(=O)=O)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1537 |
| logD: | 3.1533 |
| logSw: | -3.4399 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.914 |
| InChI Key: | YVZJXUXXVBRPDE-UHFFFAOYSA-N |