N-(2-methoxyethyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
N-(2-methoxyethyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | D256-0310 |
| Compound Name: | N-(2-methoxyethyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide |
| Molecular Weight: | 374.46 |
| Molecular Formula: | C19 H22 N2 O4 S |
| Smiles: | Cc1ccc(cc1)S(N1CCc2cc(ccc12)C(NCCOC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5437 |
| logD: | 2.5437 |
| logSw: | -2.9405 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.626 |
| InChI Key: | GBBHROMOKRSDMH-UHFFFAOYSA-N |