N-(2-ethylphenyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
N-(2-ethylphenyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | D256-0335 |
| Compound Name: | N-(2-ethylphenyl)-1-(4-methylbenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carboxamide |
| Molecular Weight: | 420.53 |
| Molecular Formula: | C24 H24 N2 O3 S |
| Smiles: | CCc1ccccc1NC(c1ccc2c(CCN2S(c2ccc(C)cc2)(=O)=O)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0827 |
| logD: | 5.0825 |
| logSw: | -4.8044 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.15 |
| InChI Key: | TZFLZOUJVKJDML-UHFFFAOYSA-N |