ethyl 4-[1-(4-chlorobenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carbonyl]piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-[1-(4-chlorobenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carbonyl]piperazine-1-carboxylate
ethyl 4-[1-(4-chlorobenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carbonyl]piperazine-1-carboxylate
Compound characteristics
| Compound ID: | D256-0536 |
| Compound Name: | ethyl 4-[1-(4-chlorobenzene-1-sulfonyl)-2,3-dihydro-1H-indole-5-carbonyl]piperazine-1-carboxylate |
| Molecular Weight: | 477.97 |
| Molecular Formula: | C22 H24 Cl N3 O5 S |
| Smiles: | CCOC(N1CCN(CC1)C(c1ccc2c(CCN2S(c2ccc(cc2)[Cl])(=O)=O)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.091 |
| logD: | 3.091 |
| logSw: | -3.5983 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 71.185 |
| InChI Key: | KSOSUTKNGABZLH-UHFFFAOYSA-N |