N-(3-cyanophenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide
Chemical Structure Depiction of
N-(3-cyanophenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide
N-(3-cyanophenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide
Compound characteristics
| Compound ID: | D262-0772 |
| Compound Name: | N-(3-cyanophenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)butanamide |
| Molecular Weight: | 358.4 |
| Molecular Formula: | C21 H18 N4 O2 |
| Smiles: | CCC(C(Nc1cccc(C#N)c1)=O)N1C(C=CC(c2ccccc2)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7281 |
| logD: | 3.728 |
| logSw: | -4.0986 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.084 |
| InChI Key: | MSFZJTBQZLWDIW-IBGZPJMESA-N |