N-(2,5-difluorophenyl)-2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]butanamide
Chemical Structure Depiction of
N-(2,5-difluorophenyl)-2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]butanamide
N-(2,5-difluorophenyl)-2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]butanamide
Compound characteristics
| Compound ID: | D262-0827 |
| Compound Name: | N-(2,5-difluorophenyl)-2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1(6H)-yl]butanamide |
| Molecular Weight: | 397.42 |
| Molecular Formula: | C22 H21 F2 N3 O2 |
| Smiles: | CCC(C(Nc1cc(ccc1F)F)=O)N1C(C=CC(c2cc(C)ccc2C)=N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2074 |
| logD: | 5.1957 |
| logSw: | -4.9293 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.33 |
| InChI Key: | KGSHXKHKBQISRU-FQEVSTJZSA-N |