N-(3,5-dimethoxyphenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)acetamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)acetamide
N-(3,5-dimethoxyphenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)acetamide
Compound characteristics
| Compound ID: | D262-1079 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-(6-oxo-3-phenylpyridazin-1(6H)-yl)acetamide |
| Molecular Weight: | 365.39 |
| Molecular Formula: | C20 H19 N3 O4 |
| Smiles: | COc1cc(cc(c1)OC)NC(CN1C(C=CC(c2ccccc2)=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0469 |
| logD: | 3.0468 |
| logSw: | -3.3864 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.784 |
| InChI Key: | AWTJKIWEGVPVSH-UHFFFAOYSA-N |