ethyl 4-amino-3-(4-chlorophenyl)-1,2-thiazole-5-carboxylate
Chemical Structure Depiction of
ethyl 4-amino-3-(4-chlorophenyl)-1,2-thiazole-5-carboxylate
ethyl 4-amino-3-(4-chlorophenyl)-1,2-thiazole-5-carboxylate
Compound characteristics
| Compound ID: | D264-0048 |
| Compound Name: | ethyl 4-amino-3-(4-chlorophenyl)-1,2-thiazole-5-carboxylate |
| Molecular Weight: | 282.75 |
| Molecular Formula: | C12 H11 Cl N2 O2 S |
| Smiles: | CCOC(c1c(c(c2ccc(cc2)[Cl])ns1)N)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3625 |
| logD: | 3.3625 |
| logSw: | -3.779 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.369 |
| InChI Key: | PEODBERTHGTAFO-UHFFFAOYSA-N |