1-[(2-chlorophenyl)methyl]-4-ethyl-7-(4-fluorophenyl)-1H-[1,2,4]triazolo[4,3-b][1,2,3]triazolo[4,5-d]pyridazine
Chemical Structure Depiction of
1-[(2-chlorophenyl)methyl]-4-ethyl-7-(4-fluorophenyl)-1H-[1,2,4]triazolo[4,3-b][1,2,3]triazolo[4,5-d]pyridazine
1-[(2-chlorophenyl)methyl]-4-ethyl-7-(4-fluorophenyl)-1H-[1,2,4]triazolo[4,3-b][1,2,3]triazolo[4,5-d]pyridazine
Compound characteristics
| Compound ID: | D264-0121 |
| Compound Name: | 1-[(2-chlorophenyl)methyl]-4-ethyl-7-(4-fluorophenyl)-1H-[1,2,4]triazolo[4,3-b][1,2,3]triazolo[4,5-d]pyridazine |
| Molecular Weight: | 407.84 |
| Molecular Formula: | C20 H15 Cl F N7 |
| Smiles: | CCc1c2c(c3nnc(c4ccc(cc4)F)n3n1)n(Cc1ccccc1[Cl])nn2 |
| Stereo: | ACHIRAL |
| logP: | 3.6919 |
| logD: | 3.6914 |
| logSw: | -4.0882 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 60.181 |
| InChI Key: | ZSGXMDPTIMSNLQ-UHFFFAOYSA-N |