7-(azepan-1-yl)-3-(4-fluorophenyl)[1,2]thiazolo[4,5-d]pyrimidine
Chemical Structure Depiction of
7-(azepan-1-yl)-3-(4-fluorophenyl)[1,2]thiazolo[4,5-d]pyrimidine
7-(azepan-1-yl)-3-(4-fluorophenyl)[1,2]thiazolo[4,5-d]pyrimidine
Compound characteristics
| Compound ID: | D264-0165 |
| Compound Name: | 7-(azepan-1-yl)-3-(4-fluorophenyl)[1,2]thiazolo[4,5-d]pyrimidine |
| Molecular Weight: | 328.41 |
| Molecular Formula: | C17 H17 F N4 S |
| Smiles: | C1CCCN(CC1)c1c2c(c(c3ccc(cc3)F)ns2)ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.7707 |
| logD: | 4.7679 |
| logSw: | -4.6888 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 35.241 |
| InChI Key: | BDBUQGIJWUSCBB-UHFFFAOYSA-N |