N-({1-[(2-chlorophenyl)methyl]piperidin-4-yl}methyl)-N'-(2-ethylphenyl)urea
Chemical Structure Depiction of
N-({1-[(2-chlorophenyl)methyl]piperidin-4-yl}methyl)-N'-(2-ethylphenyl)urea
N-({1-[(2-chlorophenyl)methyl]piperidin-4-yl}methyl)-N'-(2-ethylphenyl)urea
Compound characteristics
| Compound ID: | D264-0558 |
| Compound Name: | N-({1-[(2-chlorophenyl)methyl]piperidin-4-yl}methyl)-N'-(2-ethylphenyl)urea |
| Molecular Weight: | 385.94 |
| Molecular Formula: | C22 H28 Cl N3 O |
| Smiles: | CCc1ccccc1NC(NCC1CCN(CC1)Cc1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9418 |
| logD: | 3.3055 |
| logSw: | -4.7778 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.898 |
| InChI Key: | UDPMRAXPOHLFCO-UHFFFAOYSA-N |