N-(3-methylphenyl)-N'-({1-[(2-methylphenyl)methyl]piperidin-4-yl}methyl)urea
Chemical Structure Depiction of
N-(3-methylphenyl)-N'-({1-[(2-methylphenyl)methyl]piperidin-4-yl}methyl)urea
N-(3-methylphenyl)-N'-({1-[(2-methylphenyl)methyl]piperidin-4-yl}methyl)urea
Compound characteristics
| Compound ID: | D264-0639 |
| Compound Name: | N-(3-methylphenyl)-N'-({1-[(2-methylphenyl)methyl]piperidin-4-yl}methyl)urea |
| Molecular Weight: | 351.49 |
| Molecular Formula: | C22 H29 N3 O |
| Smiles: | Cc1cccc(c1)NC(NCC1CCN(CC1)Cc1ccccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.936 |
| logD: | 2.9678 |
| logSw: | -4.6175 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.596 |
| InChI Key: | KZYMIVSHEZHBTD-UHFFFAOYSA-N |