N-(3-chloro-4-fluorophenyl)-N'-({1-[(3-methylphenyl)methyl]piperidin-4-yl}methyl)urea
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-N'-({1-[(3-methylphenyl)methyl]piperidin-4-yl}methyl)urea
N-(3-chloro-4-fluorophenyl)-N'-({1-[(3-methylphenyl)methyl]piperidin-4-yl}methyl)urea
Compound characteristics
| Compound ID: | D264-0675 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-N'-({1-[(3-methylphenyl)methyl]piperidin-4-yl}methyl)urea |
| Molecular Weight: | 389.9 |
| Molecular Formula: | C21 H25 Cl F N3 O |
| Smiles: | Cc1cccc(CN2CCC(CC2)CNC(Nc2ccc(c(c2)[Cl])F)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.1801 |
| logD: | 2.6878 |
| logSw: | -5.5857 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.596 |
| InChI Key: | BKYIVNQKSIGXRM-UHFFFAOYSA-N |