N-(4-fluorophenyl)-N'-[2-(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)ethyl]urea
Chemical Structure Depiction of
N-(4-fluorophenyl)-N'-[2-(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)ethyl]urea
N-(4-fluorophenyl)-N'-[2-(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)ethyl]urea
Compound characteristics
| Compound ID: | D264-0881 |
| Compound Name: | N-(4-fluorophenyl)-N'-[2-(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)ethyl]urea |
| Molecular Weight: | 329.33 |
| Molecular Formula: | C17 H16 F N3 O3 |
| Smiles: | Cc1ccc2c(c1)N(CCNC(Nc1ccc(cc1)F)=O)C(=O)O2 |
| Stereo: | ACHIRAL |
| logP: | 3.1046 |
| logD: | 3.1046 |
| logSw: | -3.3997 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.784 |
| InChI Key: | ZLBFBCOTUZTCJL-UHFFFAOYSA-N |