N-(4-chloro-2-methoxy-5-methylphenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
N-(4-chloro-2-methoxy-5-methylphenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide
N-(4-chloro-2-methoxy-5-methylphenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | D265-0084 |
| Compound Name: | N-(4-chloro-2-methoxy-5-methylphenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 310.8 |
| Molecular Formula: | C14 H15 Cl N2 O2 S |
| Smiles: | Cc1cc(c(cc1[Cl])OC)NC(c1c(C)nc(C)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8914 |
| logD: | 3.7986 |
| logSw: | -4.3627 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.651 |
| InChI Key: | XDHDSJDSURZNGZ-UHFFFAOYSA-N |