2-(2-methyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)acetamide
Chemical Structure Depiction of
2-(2-methyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)acetamide
2-(2-methyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)acetamide
Compound characteristics
| Compound ID: | D265-0315 |
| Compound Name: | 2-(2-methyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)acetamide |
| Molecular Weight: | 311.38 |
| Molecular Formula: | C12 H13 N3 O3 S2 |
| Smiles: | Cc1nc(CC(Nc2ccc(cc2)S(N)(=O)=O)=O)cs1 |
| Stereo: | ACHIRAL |
| logP: | 0.9073 |
| logD: | 0.9062 |
| logSw: | -2.1554 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 84.026 |
| InChI Key: | DXJBBDSSDONCDO-UHFFFAOYSA-N |