3-oxo-5,6-diphenyl-N-{3-[(propan-2-yl)oxy]propyl}-2,3-dihydropyridazine-4-carboxamide
Chemical Structure Depiction of
3-oxo-5,6-diphenyl-N-{3-[(propan-2-yl)oxy]propyl}-2,3-dihydropyridazine-4-carboxamide
3-oxo-5,6-diphenyl-N-{3-[(propan-2-yl)oxy]propyl}-2,3-dihydropyridazine-4-carboxamide
Compound characteristics
| Compound ID: | D266-0031 |
| Compound Name: | 3-oxo-5,6-diphenyl-N-{3-[(propan-2-yl)oxy]propyl}-2,3-dihydropyridazine-4-carboxamide |
| Molecular Weight: | 391.47 |
| Molecular Formula: | C23 H25 N3 O3 |
| Smiles: | CC(C)OCCCNC(C1=C(C(c2ccccc2)=NNC1=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2045 |
| logD: | 2.7502 |
| logSw: | -3.4113 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.085 |
| InChI Key: | PRWJISOAVIDZGQ-UHFFFAOYSA-N |