dimethyl 2-[(3-oxo-5,6-diphenyl-2,3-dihydropyridazine-4-carbonyl)amino]benzene-1,4-dicarboxylate
Chemical Structure Depiction of
dimethyl 2-[(3-oxo-5,6-diphenyl-2,3-dihydropyridazine-4-carbonyl)amino]benzene-1,4-dicarboxylate
dimethyl 2-[(3-oxo-5,6-diphenyl-2,3-dihydropyridazine-4-carbonyl)amino]benzene-1,4-dicarboxylate
Compound characteristics
| Compound ID: | D266-0069 |
| Compound Name: | dimethyl 2-[(3-oxo-5,6-diphenyl-2,3-dihydropyridazine-4-carbonyl)amino]benzene-1,4-dicarboxylate |
| Molecular Weight: | 483.48 |
| Molecular Formula: | C27 H21 N3 O6 |
| Smiles: | COC(c1ccc(C(=O)OC)c(c1)NC(C1=C(C(c2ccccc2)=NNC1=O)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3504 |
| logD: | 3.4933 |
| logSw: | -4.4235 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 101.099 |
| InChI Key: | ZIQSINITDREYRB-UHFFFAOYSA-N |