N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-3-methylbenzamide
Chemical Structure Depiction of
N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-3-methylbenzamide
N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-3-methylbenzamide
Compound characteristics
| Compound ID: | D269-0226 |
| Compound Name: | N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-3-methylbenzamide |
| Molecular Weight: | 313.35 |
| Molecular Formula: | C16 H12 F N3 O S |
| Smiles: | [H]N(C(c1cccc(C)c1)=O)c1nc(c2ccc(cc2)F)ns1 |
| Stereo: | ACHIRAL |
| logP: | 4.4315 |
| logD: | 4.4134 |
| logSw: | -4.407 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.917 |
| InChI Key: | JWDRKNDIKUUUFO-UHFFFAOYSA-N |