N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-2-(4-methoxyphenyl)acetamide
Chemical Structure Depiction of
N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-2-(4-methoxyphenyl)acetamide
N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-2-(4-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | D269-0318 |
| Compound Name: | N-[3-(4-fluorophenyl)-1,2,4-thiadiazol-5-yl]-2-(4-methoxyphenyl)acetamide |
| Molecular Weight: | 343.38 |
| Molecular Formula: | C17 H14 F N3 O2 S |
| Smiles: | [H]N(C(Cc1ccc(cc1)OC)=O)c1nc(c2ccc(cc2)F)ns1 |
| Stereo: | ACHIRAL |
| logP: | 3.832 |
| logD: | 3.8313 |
| logSw: | -4.1215 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.248 |
| InChI Key: | PLBRKNQJNHORCX-UHFFFAOYSA-N |