2-(4-ethylphenoxy)-N-[4-(4-propoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide
Chemical Structure Depiction of
2-(4-ethylphenoxy)-N-[4-(4-propoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide
2-(4-ethylphenoxy)-N-[4-(4-propoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide
Compound characteristics
| Compound ID: | D269-0802 |
| Compound Name: | 2-(4-ethylphenoxy)-N-[4-(4-propoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide |
| Molecular Weight: | 395.46 |
| Molecular Formula: | C22 H25 N3 O4 |
| Smiles: | [H]N(C(C(C)Oc1ccc(CC)cc1)=O)c1c(c2ccc(cc2)OCCC)non1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.8476 |
| logD: | 5.841 |
| logSw: | -5.4857 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.293 |
| InChI Key: | CILFIXFLELZWIQ-HNNXBMFYSA-N |