N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-3-methoxybenzamide
Chemical Structure Depiction of
N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-3-methoxybenzamide
N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-3-methoxybenzamide
Compound characteristics
| Compound ID: | D269-0819 |
| Compound Name: | N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-3-methoxybenzamide |
| Molecular Weight: | 367.4 |
| Molecular Formula: | C20 H21 N3 O4 |
| Smiles: | [H]N(C(c1cccc(c1)OC)=O)c1c(c2ccc(cc2)OCCCC)non1 |
| Stereo: | ACHIRAL |
| logP: | 5.0806 |
| logD: | 5.0552 |
| logSw: | -4.7859 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.048 |
| InChI Key: | TVVYBNVTPYQGKQ-UHFFFAOYSA-N |