N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-chlorobenzamide
Chemical Structure Depiction of
N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-chlorobenzamide
N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-chlorobenzamide
Compound characteristics
| Compound ID: | D269-0820 |
| Compound Name: | N-[4-(4-butoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-chlorobenzamide |
| Molecular Weight: | 371.82 |
| Molecular Formula: | C19 H18 Cl N3 O3 |
| Smiles: | [H]N(C(c1ccccc1[Cl])=O)c1c(c2ccc(cc2)OCCCC)non1 |
| Stereo: | ACHIRAL |
| logP: | 5.4736 |
| logD: | 4.9792 |
| logSw: | -5.7365 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.504 |
| InChI Key: | FXNRNLMJIDAEIL-UHFFFAOYSA-N |