N-[4-(4-ethoxyphenyl)-1,2,5-oxadiazol-3-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
N-[4-(4-ethoxyphenyl)-1,2,5-oxadiazol-3-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide
N-[4-(4-ethoxyphenyl)-1,2,5-oxadiazol-3-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | D269-1109 |
| Compound Name: | N-[4-(4-ethoxyphenyl)-1,2,5-oxadiazol-3-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide |
| Molecular Weight: | 391.43 |
| Molecular Formula: | C22 H21 N3 O4 |
| Smiles: | [H]N(C(c1c(C)c2cc(C)c(C)cc2o1)=O)c1c(c2ccc(cc2)OCC)non1 |
| Stereo: | ACHIRAL |
| logP: | 5.9909 |
| logD: | 5.824 |
| logSw: | -5.5525 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.736 |
| InChI Key: | DQAULYQDONCONR-UHFFFAOYSA-N |