5-(3-hydroxyphenyl)-2-[(prop-2-en-1-yl)sulfanyl]-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione
Chemical Structure Depiction of
5-(3-hydroxyphenyl)-2-[(prop-2-en-1-yl)sulfanyl]-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione
5-(3-hydroxyphenyl)-2-[(prop-2-en-1-yl)sulfanyl]-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione
Compound characteristics
| Compound ID: | D271-0056 |
| Compound Name: | 5-(3-hydroxyphenyl)-2-[(prop-2-en-1-yl)sulfanyl]-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione |
| Molecular Weight: | 329.38 |
| Molecular Formula: | C16 H15 N3 O3 S |
| Smiles: | C=CCSC1NC(C2C(CC(NC=2N=1)=O)c1cccc(c1)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3902 |
| logD: | 1.3803 |
| logSw: | -2.082 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 75.757 |
| InChI Key: | WDBOLIXHLVRHOL-LLVKDONJSA-N |