5-(2,5-dimethylphenyl)-2-(ethylsulfanyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione
Chemical Structure Depiction of
5-(2,5-dimethylphenyl)-2-(ethylsulfanyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione
5-(2,5-dimethylphenyl)-2-(ethylsulfanyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione
Compound characteristics
| Compound ID: | D271-0114 |
| Compound Name: | 5-(2,5-dimethylphenyl)-2-(ethylsulfanyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione |
| Molecular Weight: | 329.42 |
| Molecular Formula: | C17 H19 N3 O2 S |
| Smiles: | CCSC1NC(C2C(CC(NC=2N=1)=O)c1cc(C)ccc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5653 |
| logD: | 2.5476 |
| logSw: | -2.9017 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.14 |
| InChI Key: | HXGIXZKDEPZASP-GFCCVEGCSA-N |