N-[(5-bromo-2-ethoxyphenyl)methyl]-3-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-1-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-[(5-bromo-2-ethoxyphenyl)methyl]-3-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-1-amine--hydrogen chloride (1/1)
N-[(5-bromo-2-ethoxyphenyl)methyl]-3-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-1-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D272-0601 |
| Compound Name: | N-[(5-bromo-2-ethoxyphenyl)methyl]-3-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]propan-1-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 422.77 |
| Molecular Formula: | C14 H20 Br N5 O S |
| Salt: | HCl |
| Smiles: | [H]N(CCCSc1nnnn1C)Cc1cc(ccc1OCC)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.3025 |
| logD: | -0.6309 |
| logSw: | -2.7144 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.399 |
| InChI Key: | OJDFEVNMAVBJNW-UHFFFAOYSA-N |