5-({[4-(benzyloxy)-3-ethoxyphenyl]methyl}amino)-1,3-dihydro-2H-benzimidazol-2-one
Chemical Structure Depiction of
5-({[4-(benzyloxy)-3-ethoxyphenyl]methyl}amino)-1,3-dihydro-2H-benzimidazol-2-one
5-({[4-(benzyloxy)-3-ethoxyphenyl]methyl}amino)-1,3-dihydro-2H-benzimidazol-2-one
Compound characteristics
| Compound ID: | D272-0793 |
| Compound Name: | 5-({[4-(benzyloxy)-3-ethoxyphenyl]methyl}amino)-1,3-dihydro-2H-benzimidazol-2-one |
| Molecular Weight: | 389.45 |
| Molecular Formula: | C23 H23 N3 O3 |
| Smiles: | [H]N(Cc1ccc(c(c1)OCC)OCc1ccccc1)c1ccc2c(c1)NC(N2)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6312 |
| logD: | 3.6307 |
| logSw: | -3.8329 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 60.724 |
| InChI Key: | RFENEBCOLGVIAD-UHFFFAOYSA-N |