2-{[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl}-4,6-dimethyl-N-phenylpyridine-3-carboxamide
Chemical Structure Depiction of
2-{[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl}-4,6-dimethyl-N-phenylpyridine-3-carboxamide
2-{[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl}-4,6-dimethyl-N-phenylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | D276-0068 |
| Compound Name: | 2-{[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl}-4,6-dimethyl-N-phenylpyridine-3-carboxamide |
| Molecular Weight: | 484.41 |
| Molecular Formula: | C23 H22 Br N3 O2 S |
| Smiles: | Cc1cc(ccc1NC(CSc1c(C(Nc2ccccc2)=O)c(C)cc(C)n1)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.1714 |
| logD: | 5.1707 |
| logSw: | -5.0367 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.063 |
| InChI Key: | SUHXXXUFGPZUFX-UHFFFAOYSA-N |