N-(4-chlorophenyl)-2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-4,6-dimethylpyridine-3-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-4,6-dimethylpyridine-3-carboxamide
N-(4-chlorophenyl)-2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-4,6-dimethylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | D276-0200 |
| Compound Name: | N-(4-chlorophenyl)-2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-4,6-dimethylpyridine-3-carboxamide |
| Molecular Weight: | 428.91 |
| Molecular Formula: | C22 H18 Cl F N2 O2 S |
| Smiles: | Cc1cc(C)nc(c1C(Nc1ccc(cc1)[Cl])=O)SCC(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2959 |
| logD: | 5.2537 |
| logSw: | -6.1685 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.859 |
| InChI Key: | CVLUXQLKAHZZRV-UHFFFAOYSA-N |